C12H17FN4O2S — CID 63668491
5-fluoro-2-(4-methylsulfonylpiperazin-1-yl)benzenecarboximidamide (PubChem CID 63668491) has the molecular formula C12H17FN4O2S and a molecular weight of 300.36 g/mol. Its IUPAC name is 5-fluoro-2-(4-methylsulfonylpiperazin-1-yl)benzenecarboximidamide.
| Compound Name | 5-fluoro-2-(4-methylsulfonylpiperazin-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 63668491 |
| Molecular Formula | C12H17FN4O2S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 5-fluoro-2-(4-methylsulfonylpiperazin-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)ccc1N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H17FN4O2S/c1-20(18,19)17-6-4-16(5-7-17)11-3-2-9(13)8-10(11)12(14)15/h2-3,8H,4-7H2,1H3,(H3,14,15) |
| InChIKey | DSMCKGDCTDNDMI-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|