C11H17N5O2S — CID 62993614
2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carboximidamide (PubChem CID 62993614) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carboximidamide.
| Compound Name | 2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 62993614 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(4-methylsulfonylpiperazin-1-yl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccnc1N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C11H17N5O2S/c1-19(17,18)16-7-5-15(6-8-16)11-9(10(12)13)3-2-4-14-11/h2-4H,5-8H2,1H3,(H3,12,13) |
| InChIKey | HEXSGBITLDSBRM-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|