C12H17N3OS — CID 107930407
5-methyl-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide (PubChem CID 107930407) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is 5-methyl-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide.
| Compound Name | 5-methyl-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107930407 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 5-methyl-2-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)ccc1N1CCS(=O)CC1 |
| InChI | InChI=1S/C12H17N3OS/c1-9-2-3-11(10(8-9)12(13)14)15-4-6-17(16)7-5-15/h2-3,8H,4-7H2,1H3,(H3,13,14) |
| InChIKey | NKSZHJHFCCYOQI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|