C14H21N3 — CID 107930509
2-(2,2-dimethylpyrrolidin-1-yl)-5-methylbenzenecarboximidamide (PubChem CID 107930509) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(2,2-dimethylpyrrolidin-1-yl)-5-methylbenzenecarboximidamide.
| Compound Name | 2-(2,2-dimethylpyrrolidin-1-yl)-5-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107930509 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 2-(2,2-dimethylpyrrolidin-1-yl)-5-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)ccc1N1CCCC1(C)C |
| InChI | InChI=1S/C14H21N3/c1-10-5-6-12(11(9-10)13(15)16)17-8-4-7-14(17,2)3/h5-6,9H,4,7-8H2,1-3H3,(H3,15,16) |
| InChIKey | JZMBCZLZUHVUMH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|