C11H13F2N3OS — CID 81294670
3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide (PubChem CID 81294670) has the molecular formula C11H13F2N3OS and a molecular weight of 273.31 g/mol. Its IUPAC name is 3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide.
| Compound Name | 3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 81294670 |
| Molecular Formula | C11H13F2N3OS |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3,5-difluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(N2CCS(=O)CC2)c(F)c1 |
| InChI | InChI=1S/C11H13F2N3OS/c12-8-5-7(11(14)15)6-9(13)10(8)16-1-3-18(17)4-2-16/h5-6H,1-4H2,(H3,14,15) |
| InChIKey | LQSGTIVJOKRRSZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|