C15H20F2N4 — CID 81285670
3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide (PubChem CID 81285670) has the molecular formula C15H20F2N4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide.
| Compound Name | 3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 81285670 |
| Molecular Formula | C15H20F2N4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3,5-difluoro-4-(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(F)c(N2CCC3CCC(C2)N3C)c(F)c1 |
| InChI | InChI=1S/C15H20F2N4/c1-20-10-2-3-11(20)8-21(5-4-10)14-12(16)6-9(15(18)19)7-13(14)17/h6-7,10-11H,2-5,8H2,1H3,(H3,18,19) |
| InChIKey | WHAAQABTCJKUOX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|