C16H24N4 — CID 79175339
4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarboximidamide (PubChem CID 79175339) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarboximidamide.
| Compound Name | 4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 79175339 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CCC3CCC(C2)N3C)cc1 |
| InChI | InChI=1S/C16H24N4/c1-19-14-6-7-15(19)11-20(9-8-14)10-12-2-4-13(5-3-12)16(17)18/h2-5,14-15H,6-11H2,1H3,(H3,17,18) |
| InChIKey | AHGOSDPEWPDXON-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|