C21H26ClN3O2 — CID 67576280
methyl 2-[1-[[4-(4-carbamimidoylphenyl)phenyl]methyl]pyrrolidin-3-yl]acetate;hydrochloride (PubChem CID 67576280) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is methyl 2-[1-[[4-(4-carbamimidoylphenyl)phenyl]methyl]pyrrolidin-3-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[1-[[4-(4-carbamimidoylphenyl)phenyl]methyl]pyrrolidin-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 67576280 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | methyl 2-[1-[[4-(4-carbamimidoylphenyl)phenyl]methyl]pyrrolidin-3-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(CN3CCC(CC(=O)OC)C3)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O2.ClH/c1-26-20(25)12-16-10-11-24(14-16)13-15-2-4-17(5-3-15)18-6-8-19(9-7-18)21(22)23;/h2-9,16H,10-14H2,1H3,(H3,22,23);1H |
| InChIKey | FWELXTWQRYDTJN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|