C21H32N4O2 — CID 19391523
methyl 2-[1-[[1-(4-carbamimidoylphenyl)piperidin-4-yl]methyl]piperidin-4-yl]acetate (PubChem CID 19391523) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is methyl 2-[1-[[1-(4-carbamimidoylphenyl)piperidin-4-yl]methyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[[1-(4-carbamimidoylphenyl)piperidin-4-yl]methyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 19391523 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | methyl 2-[1-[[1-(4-carbamimidoylphenyl)piperidin-4-yl]methyl]piperidin-4-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(CN3CCC(CC(=O)OC)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H32N4O2/c1-27-20(26)14-16-6-10-24(11-7-16)15-17-8-12-25(13-9-17)19-4-2-18(3-5-19)21(22)23/h2-5,16-17H,6-15H2,1H3,(H3,22,23) |
| InChIKey | WTWAUWKUGWAVGF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|