C21H32ClN5O5S — CID 22856607
methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylsulfonylamino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride (PubChem CID 22856607) has the molecular formula C21H32ClN5O5S and a molecular weight of 502.04 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylsulfonylamino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride.
| Compound Name | methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylsulfonylamino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 22856607 |
| Molecular Formula | C21H32ClN5O5S |
| Molecular Weight | 502.04 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylsulfonylamino]methyl]-2-oxopyrrolidin-3-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N2CCC(N(C[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3)S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C21H31N5O5S.ClH/c1-31-19(27)12-15-11-16(24-21(15)28)13-26(32(2,29)30)18-7-9-25(10-8-18)17-5-3-14(4-6-17)20(22)23;/h3-6,15-16,18H,7-13H2,1-2H3,(H3,22,23)(H,24,28);1H/t15-,16-;/m0./s1 |
| InChIKey | VYMJSULBLMEJTN-MOGJOVFKSA-N |
| XLogP | 0.69 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.04 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|