C20H22N4O3 — CID 54509657
methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate (PubChem CID 54509657) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 54509657 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(c3ccc(CCC(=O)OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H22N4O3/c1-27-18(25)11-4-14-2-7-16(8-3-14)23-12-13-24(20(23)26)17-9-5-15(6-10-17)19(21)22/h2-3,5-10H,4,11-13H2,1H3,(H3,21,22) |
| InChIKey | YIEWUIGJBWCRTH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|