C21H21N3O4 — CID 57083346
methyl 3-[4-[1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoate (PubChem CID 57083346) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is methyl 3-[4-[1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 57083346 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | methyl 3-[4-[1-(4-carbamimidoylphenyl)-2,4-dioxopyrrolidin-3-yl]phenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(=O)C(c3ccc(CCC(=O)OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-28-18(26)11-4-13-2-5-14(6-3-13)19-17(25)12-24(21(19)27)16-9-7-15(8-10-16)20(22)23/h2-3,5-10,19H,4,11-12H2,1H3,(H3,22,23) |
| InChIKey | IQLWQYYRILHVID-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|