C20H21FN4O3 — CID 22098302
methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-fluorophenyl]propanoate (PubChem CID 22098302) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-fluorophenyl]propanoate.
| Compound Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 22098302 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-fluorophenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(c3ccc(CCC(=O)OC)cc3F)C2=O)cc1 |
| InChI | InChI=1S/C20H21FN4O3/c1-28-18(26)9-3-13-2-8-17(16(21)12-13)25-11-10-24(20(25)27)15-6-4-14(5-7-15)19(22)23/h2,4-8,12H,3,9-11H2,1H3,(H3,22,23) |
| InChIKey | DOLPKXUXISNFPX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|