C20H25Cl2N5O3 — CID 22098614
methyl 2-amino-3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate;dihydrochloride (PubChem CID 22098614) has the molecular formula C20H25Cl2N5O3 and a molecular weight of 454.36 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate;dihydrochloride.
| Compound Name | methyl 2-amino-3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate;dihydrochloride |
|---|---|
| PubChem CID | 22098614 |
| Molecular Formula | C20H25Cl2N5O3 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | methyl 2-amino-3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]phenyl]propanoate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(N2CCN(c3ccc(CC(N)C(=O)OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H23N5O3.2ClH/c1-28-19(26)17(21)12-13-2-6-15(7-3-13)24-10-11-25(20(24)27)16-8-4-14(5-9-16)18(22)23;;/h2-9,17H,10-12,21H2,1H3,(H3,22,23);2*1H |
| InChIKey | UXNZYYQUOWDSMG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|