C16H22N4O3 — CID 18989509
2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 18989509) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 18989509 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(C(C(=O)O)C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C16H22N4O3/c1-16(2,3)12(14(21)22)20-9-8-19(15(20)23)11-6-4-10(5-7-11)13(17)18/h4-7,12H,8-9H2,1-3H3,(H3,17,18)(H,21,22) |
| InChIKey | WSFXWCBEJCYEEY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|