C17H21N5O6 — CID 18989483
3-[[2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]pentanedioic acid (PubChem CID 18989483) has the molecular formula C17H21N5O6 and a molecular weight of 391.38 g/mol. Its IUPAC name is 3-[[2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]pentanedioic acid.
| Compound Name | 3-[[2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18989483 |
| Molecular Formula | C17H21N5O6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-[[2-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]acetyl]amino]pentanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(CC(=O)NC(CC(=O)O)CC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C17H21N5O6/c18-16(19)10-1-3-12(4-2-10)22-6-5-21(17(22)28)9-13(23)20-11(7-14(24)25)8-15(26)27/h1-4,11H,5-9H2,(H3,18,19)(H,20,23)(H,24,25)(H,26,27) |
| InChIKey | ABZQRCZDFOXPGM-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 177.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|