C19H24N4O4 — CID 70084595
3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]pent-4-enoic acid (PubChem CID 70084595) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]pent-4-enoic acid.
| Compound Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]pent-4-enoic acid |
|---|---|
| PubChem CID | 70084595 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]pent-4-enoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCCC(CC(=O)NC(C=C)CC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-2-14(11-17(25)26)22-16(24)10-13-4-3-9-23(19(13)27)15-7-5-12(6-8-15)18(20)21/h2,5-8,13-14H,1,3-4,9-11H2,(H3,20,21)(H,22,24)(H,25,26) |
| InChIKey | NJHBTJIFZIWRDG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|