C13H15NO3 — CID 115039422
2-(2-oxo-1-phenylpiperidin-3-yl)acetic acid (PubChem CID 115039422) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(2-oxo-1-phenylpiperidin-3-yl)acetic acid.
| Compound Name | 2-(2-oxo-1-phenylpiperidin-3-yl)acetic acid |
|---|---|
| PubChem CID | 115039422 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(2-oxo-1-phenylpiperidin-3-yl)acetic acid |
| SMILES | O=C(O)CC1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H15NO3/c15-12(16)9-10-5-4-8-14(13(10)17)11-6-2-1-3-7-11/h1-3,6-7,10H,4-5,8-9H2,(H,15,16) |
| InChIKey | AHSQKYQVKGXREV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |