C15H16N2O2 — CID 125451049
(2S)-2-methyl-3-oxo-3-[(3S)-2-oxo-1-phenylpiperidin-3-yl]propanenitrile (PubChem CID 125451049) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (2S)-2-methyl-3-oxo-3-[(3S)-2-oxo-1-phenylpiperidin-3-yl]propanenitrile.
| Compound Name | (2S)-2-methyl-3-oxo-3-[(3S)-2-oxo-1-phenylpiperidin-3-yl]propanenitrile |
|---|---|
| PubChem CID | 125451049 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (2S)-2-methyl-3-oxo-3-[(3S)-2-oxo-1-phenylpiperidin-3-yl]propanenitrile |
| SMILES | C[C@@H](C#N)C(=O)[C@@H]1CCCN(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H16N2O2/c1-11(10-16)14(18)13-8-5-9-17(15(13)19)12-6-3-2-4-7-12/h2-4,6-7,11,13H,5,8-9H2,1H3/t11-,13-/m0/s1 |
| InChIKey | ZZBBRSIAYNGXEM-AAEUAGOBSA-N |
| XLogP | 2.16 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|