C15H17ClFNO2 — CID 125450772
(3S)-1-(2-chloro-3-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one (PubChem CID 125450772) has the molecular formula C15H17ClFNO2 and a molecular weight of 297.76 g/mol. Its IUPAC name is (3S)-1-(2-chloro-3-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one.
| Compound Name | (3S)-1-(2-chloro-3-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one |
|---|---|
| PubChem CID | 125450772 |
| Molecular Formula | C15H17ClFNO2 |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (3S)-1-(2-chloro-3-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one |
| SMILES | CC(C)C(=O)[C@@H]1CCCN(c2cccc(F)c2Cl)C1=O |
| InChI | InChI=1S/C15H17ClFNO2/c1-9(2)14(19)10-5-4-8-18(15(10)20)12-7-3-6-11(17)13(12)16/h3,6-7,9-10H,4-5,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | UCTSBXVYSBVDMP-JTQLQIEISA-N |
| XLogP | 3.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|