C15H17BrFNO2 — CID 125450895
(3S)-1-(2-bromo-4-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one (PubChem CID 125450895) has the molecular formula C15H17BrFNO2 and a molecular weight of 342.21 g/mol. Its IUPAC name is (3S)-1-(2-bromo-4-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one.
| Compound Name | (3S)-1-(2-bromo-4-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one |
|---|---|
| PubChem CID | 125450895 |
| Molecular Formula | C15H17BrFNO2 |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (3S)-1-(2-bromo-4-fluorophenyl)-3-(2-methylpropanoyl)piperidin-2-one |
| SMILES | CC(C)C(=O)[C@@H]1CCCN(c2ccc(F)cc2Br)C1=O |
| InChI | InChI=1S/C15H17BrFNO2/c1-9(2)14(19)11-4-3-7-18(15(11)20)13-6-5-10(17)8-12(13)16/h5-6,8-9,11H,3-4,7H2,1-2H3/t11-/m0/s1 |
| InChIKey | WPAAOPLGGSJFCZ-NSHDSACASA-N |
| XLogP | 3.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|