C17H19F2N3O3 — CID 42853506
3-(4-acetylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one (PubChem CID 42853506) has the molecular formula C17H19F2N3O3 and a molecular weight of 351.35 g/mol. Its IUPAC name is 3-(4-acetylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one.
| Compound Name | 3-(4-acetylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 42853506 |
| Molecular Formula | C17H19F2N3O3 |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-(4-acetylpiperazine-1-carbonyl)-1-(2,4-difluorophenyl)pyrrolidin-2-one |
| SMILES | CC(=O)N1CCN(C(=O)C2CCN(c3ccc(F)cc3F)C2=O)CC1 |
| InChI | InChI=1S/C17H19F2N3O3/c1-11(23)20-6-8-21(9-7-20)16(24)13-4-5-22(17(13)25)15-3-2-12(18)10-14(15)19/h2-3,10,13H,4-9H2,1H3 |
| InChIKey | RWIRWNLQFDVENI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|