C13H13FNO5S- — CID 174574016
[3-fluoro-4-(3-methoxycarbonyl-2-oxopyrrolidin-1-yl)phenyl]methanesulfinate (PubChem CID 174574016) has the molecular formula C13H13FNO5S- and a molecular weight of 314.31 g/mol. Its IUPAC name is [3-fluoro-4-(3-methoxycarbonyl-2-oxopyrrolidin-1-yl)phenyl]methanesulfinate.
| Compound Name | [3-fluoro-4-(3-methoxycarbonyl-2-oxopyrrolidin-1-yl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174574016 |
| Molecular Formula | C13H13FNO5S- |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [3-fluoro-4-(3-methoxycarbonyl-2-oxopyrrolidin-1-yl)phenyl]methanesulfinate |
| SMILES | COC(=O)C1CCN(c2ccc(CS(=O)[O-])cc2F)C1=O |
| InChI | InChI=1S/C13H14FNO5S/c1-20-13(17)9-4-5-15(12(9)16)11-3-2-8(6-10(11)14)7-21(18)19/h2-3,6,9H,4-5,7H2,1H3,(H,18,19)/p-1 |
| InChIKey | YNDXOZKFHZOPAB-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|