C18H15Cl2FN2O2 — CID 93330664
(3R)-1-(2,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 93330664) has the molecular formula C18H15Cl2FN2O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is (3R)-1-(2,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93330664 |
| Molecular Formula | C18H15Cl2FN2O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | (3R)-1-(2,4-dichlorophenyl)-N-[(4-fluorophenyl)methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)[C@H]1CCN(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H15Cl2FN2O2/c19-12-3-6-16(15(20)9-12)23-8-7-14(18(23)25)17(24)22-10-11-1-4-13(21)5-2-11/h1-6,9,14H,7-8,10H2,(H,22,24)/t14-/m1/s1 |
| InChIKey | WMVFTWGYLCDHLS-CQSZACIVSA-N |
| XLogP | 3.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|