C18H13Cl2F3N2O2 — CID 71955816
1-(2,4-dichlorophenyl)-2-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 71955816) has the molecular formula C18H13Cl2F3N2O2 and a molecular weight of 417.21 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-2-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71955816 |
| Molecular Formula | C18H13Cl2F3N2O2 |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-oxo-N-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C1CCN(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C18H13Cl2F3N2O2/c19-11-3-6-15(14(20)9-11)25-8-7-13(17(25)27)16(26)24-12-4-1-10(2-5-12)18(21,22)23/h1-6,9,13H,7-8H2,(H,24,26) |
| InChIKey | QESJDSXFWAKKAV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|