C16H18Cl2N2O3 — CID 93330668
(3S)-1-(2,4-dichlorophenyl)-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-3-carboxamide (PubChem CID 93330668) has the molecular formula C16H18Cl2N2O3 and a molecular weight of 357.24 g/mol. Its IUPAC name is (3S)-1-(2,4-dichlorophenyl)-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(2,4-dichlorophenyl)-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 93330668 |
| Molecular Formula | C16H18Cl2N2O3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (3S)-1-(2,4-dichlorophenyl)-2-oxo-N-[[(2R)-oxolan-2-yl]methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NC[C@H]1CCCO1)[C@@H]1CCN(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C16H18Cl2N2O3/c17-10-3-4-14(13(18)8-10)20-6-5-12(16(20)22)15(21)19-9-11-2-1-7-23-11/h3-4,8,11-12H,1-2,5-7,9H2,(H,19,21)/t11-,12+/m1/s1 |
| InChIKey | WZHNBEYLSHRPDJ-NEPJUHHUSA-N |
| XLogP | 2.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|