C22H22Cl2N2O4 — CID 60568694
1-(2,5-dichlorophenyl)-2-oxo-N-[3-(oxolan-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide (PubChem CID 60568694) has the molecular formula C22H22Cl2N2O4 and a molecular weight of 449.33 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-oxo-N-[3-(oxolan-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2,5-dichlorophenyl)-2-oxo-N-[3-(oxolan-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 60568694 |
| Molecular Formula | C22H22Cl2N2O4 |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-oxo-N-[3-(oxolan-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(OCC2CCCO2)c1)C1CCN(c2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C22H22Cl2N2O4/c23-14-6-7-19(24)20(11-14)26-9-8-18(22(26)28)21(27)25-15-3-1-4-16(12-15)30-13-17-5-2-10-29-17/h1,3-4,6-7,11-12,17-18H,2,5,8-10,13H2,(H,25,27) |
| InChIKey | DBVDXYFNZGXCEC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|