C20H18ClF3N2O2 — CID 7961983
1-(4-chlorobenzoyl)-N-[4-(trifluoromethyl)phenyl]piperidine-4-carboxamide (PubChem CID 7961983) has the molecular formula C20H18ClF3N2O2 and a molecular weight of 410.82 g/mol. Its IUPAC name is 1-(4-chlorobenzoyl)-N-[4-(trifluoromethyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorobenzoyl)-N-[4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7961983 |
| Molecular Formula | C20H18ClF3N2O2 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-(4-chlorobenzoyl)-N-[4-(trifluoromethyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H18ClF3N2O2/c21-16-5-1-14(2-6-16)19(28)26-11-9-13(10-12-26)18(27)25-17-7-3-15(4-8-17)20(22,23)24/h1-8,13H,9-12H2,(H,25,27) |
| InChIKey | RLHNEUNDKIBVOR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |