C19H17ClF3N3O2 — CID 58016180
N-(6-chloro-3-pyridinyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide (PubChem CID 58016180) has the molecular formula C19H17ClF3N3O2 and a molecular weight of 411.81 g/mol. Its IUPAC name is N-(6-chloro-3-pyridinyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | N-(6-chloro-3-pyridinyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58016180 |
| Molecular Formula | C19H17ClF3N3O2 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-(6-chloro-3-pyridinyl)-1-[4-(trifluoromethyl)benzoyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)C1CCN(C(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H17ClF3N3O2/c20-16-6-5-15(11-24-16)25-17(27)12-7-9-26(10-8-12)18(28)13-1-3-14(4-2-13)19(21,22)23/h1-6,11-12H,7-10H2,(H,25,27) |
| InChIKey | JWYINSUGOAHFJL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|