C11H10ClF3N2O — CID 63667119
3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 63667119) has the molecular formula C11H10ClF3N2O and a molecular weight of 278.66 g/mol. Its IUPAC name is 3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 63667119 |
| Molecular Formula | C11H10ClF3N2O |
| Molecular Weight | 278.66 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 3-amino-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | NC1CCN(c2ccc(C(F)(F)F)cc2Cl)C1=O |
| InChI | InChI=1S/C11H10ClF3N2O/c12-7-5-6(11(13,14)15)1-2-9(7)17-4-3-8(16)10(17)18/h1-2,5,8H,3-4,16H2 |
| InChIKey | IUSHWSTXAJLZQQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |