C12H10BrClF3NO — CID 168505671
4-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 168505671) has the molecular formula C12H10BrClF3NO and a molecular weight of 356.57 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168505671 |
| Molecular Formula | C12H10BrClF3NO |
| Molecular Weight | 356.57 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | 4-(bromomethyl)-1-[2-chloro-4-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H10BrClF3NO/c13-5-7-3-11(19)18(6-7)10-2-1-8(4-9(10)14)12(15,16)17/h1-2,4,7H,3,5-6H2 |
| InChIKey | DCNRDFLQBFKFBF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|