C11H9Br2Cl2NO — CID 168505260
1-(4-bromo-2,5-dichlorophenyl)-4-(bromomethyl)pyrrolidin-2-one (PubChem CID 168505260) has the molecular formula C11H9Br2Cl2NO and a molecular weight of 401.91 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dichlorophenyl)-4-(bromomethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-bromo-2,5-dichlorophenyl)-4-(bromomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168505260 |
| Molecular Formula | C11H9Br2Cl2NO |
| Molecular Weight | 401.91 g/mol |
| Exact Mass | 398.84 |
| IUPAC Name | 1-(4-bromo-2,5-dichlorophenyl)-4-(bromomethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C11H9Br2Cl2NO/c12-4-6-1-11(17)16(5-6)10-3-8(14)7(13)2-9(10)15/h2-3,6H,1,4-5H2 |
| InChIKey | MIUWOBAQYDIFJI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|