C11H9BrCl2FNO — CID 168505634
4-(bromomethyl)-1-(3,5-dichloro-4-fluorophenyl)pyrrolidin-2-one (PubChem CID 168505634) has the molecular formula C11H9BrCl2FNO and a molecular weight of 341.01 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(3,5-dichloro-4-fluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(3,5-dichloro-4-fluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168505634 |
| Molecular Formula | C11H9BrCl2FNO |
| Molecular Weight | 341.01 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | 4-(bromomethyl)-1-(3,5-dichloro-4-fluorophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H9BrCl2FNO/c12-4-6-1-10(17)16(5-6)7-2-8(13)11(15)9(14)3-7/h2-3,6H,1,4-5H2 |
| InChIKey | XXBSORNPRHKXDF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.01 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|