C12H9Br2ClFNO3 — CID 168505284
4-bromo-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-chloro-3-fluorobenzoic acid (PubChem CID 168505284) has the molecular formula C12H9Br2ClFNO3 and a molecular weight of 429.47 g/mol. Its IUPAC name is 4-bromo-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-chloro-3-fluorobenzoic acid.
| Compound Name | 4-bromo-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-chloro-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 168505284 |
| Molecular Formula | C12H9Br2ClFNO3 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 426.86 |
| IUPAC Name | 4-bromo-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-chloro-3-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(Br)c(F)c1N1CC(CBr)CC1=O |
| InChI | InChI=1S/C12H9Br2ClFNO3/c13-3-5-1-8(18)17(4-5)11-6(12(19)20)2-7(15)9(14)10(11)16/h2,5H,1,3-4H2,(H,19,20) |
| InChIKey | BTMXIZDVYIMGCV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|