C10H9BrCl2N2O — CID 168700400
4-amino-1-(4-bromo-2,5-dichlorophenyl)pyrrolidin-2-one (PubChem CID 168700400) has the molecular formula C10H9BrCl2N2O and a molecular weight of 324.01 g/mol. Its IUPAC name is 4-amino-1-(4-bromo-2,5-dichlorophenyl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-(4-bromo-2,5-dichlorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168700400 |
| Molecular Formula | C10H9BrCl2N2O |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | 4-amino-1-(4-bromo-2,5-dichlorophenyl)pyrrolidin-2-one |
| SMILES | NC1CC(=O)N(c2cc(Cl)c(Br)cc2Cl)C1 |
| InChI | InChI=1S/C10H9BrCl2N2O/c11-6-2-8(13)9(3-7(6)12)15-4-5(14)1-10(15)16/h2-3,5H,1,4,14H2 |
| InChIKey | BPFJIZHYUWCMGI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|