C12H11F4NOS — CID 168671674
1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671674) has the molecular formula C12H11F4NOS and a molecular weight of 293.29 g/mol. Its IUPAC name is 1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671674 |
| Molecular Formula | C12H11F4NOS |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 1-[2-fluoro-4-(trifluoromethyl)phenyl]-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C12H11F4NOS/c13-9-4-8(12(14,15)16)1-2-10(9)17-5-7(6-19)3-11(17)18/h1-2,4,7,19H,3,5-6H2 |
| InChIKey | YATJHNSTRYGVHS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|