C10H11FN2OS — CID 168671786
1-(3-fluoro-4-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671786) has the molecular formula C10H11FN2OS and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671786 |
| Molecular Formula | C10H11FN2OS |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1ccncc1F |
| InChI | InChI=1S/C10H11FN2OS/c11-8-4-12-2-1-9(8)13-5-7(6-15)3-10(13)14/h1-2,4,7,15H,3,5-6H2 |
| InChIKey | DCIROSNETJSXSK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|