C11H11FINOS — CID 168671432
1-(5-fluoro-2-iodophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671432) has the molecular formula C11H11FINOS and a molecular weight of 351.18 g/mol. Its IUPAC name is 1-(5-fluoro-2-iodophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-fluoro-2-iodophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671432 |
| Molecular Formula | C11H11FINOS |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | 1-(5-fluoro-2-iodophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1cc(F)ccc1I |
| InChI | InChI=1S/C11H11FINOS/c12-8-1-2-9(13)10(4-8)14-5-7(6-16)3-11(14)15/h1-2,4,7,16H,3,5-6H2 |
| InChIKey | WXRHNDITMSUXFN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|