C10H12BrN3OS — CID 168672242
1-(4-amino-5-bromo-3-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168672242) has the molecular formula C10H12BrN3OS and a molecular weight of 302.20 g/mol. Its IUPAC name is 1-(4-amino-5-bromo-3-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-amino-5-bromo-3-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168672242 |
| Molecular Formula | C10H12BrN3OS |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 1-(4-amino-5-bromo-3-pyridinyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | Nc1c(Br)cncc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C10H12BrN3OS/c11-7-2-13-3-8(10(7)12)14-4-6(5-16)1-9(14)15/h2-3,6,16H,1,4-5H2,(H2,12,13) |
| InChIKey | CSDIMRKFSFDOIY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|