C10H11BrFN3O3S — CID 168677750
[1-(4-amino-5-bromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677750) has the molecular formula C10H11BrFN3O3S and a molecular weight of 352.19 g/mol. Its IUPAC name is [1-(4-amino-5-bromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(4-amino-5-bromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677750 |
| Molecular Formula | C10H11BrFN3O3S |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | [1-(4-amino-5-bromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Nc1c(Br)cncc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H11BrFN3O3S/c11-7-2-14-3-8(10(7)13)15-4-6(1-9(15)16)5-19(12,17)18/h2-3,6H,1,4-5H2,(H2,13,14) |
| InChIKey | YQVUVSZTVYSGPH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |