C11H11BrF2N2O3S — CID 168677483
[1-(2-amino-5-bromo-3-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677483) has the molecular formula C11H11BrF2N2O3S and a molecular weight of 369.19 g/mol. Its IUPAC name is [1-(2-amino-5-bromo-3-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(2-amino-5-bromo-3-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677483 |
| Molecular Formula | C11H11BrF2N2O3S |
| Molecular Weight | 369.19 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | [1-(2-amino-5-bromo-3-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | Nc1c(F)cc(Br)cc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H11BrF2N2O3S/c12-7-2-8(13)11(15)9(3-7)16-4-6(1-10(16)17)5-20(14,18)19/h2-3,6H,1,4-5,15H2 |
| InChIKey | CXDAKEAGRFMSFY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|