C11H12BrFN2O4S — CID 168675726
[1-(2-bromo-6-methoxy-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675726) has the molecular formula C11H12BrFN2O4S and a molecular weight of 367.20 g/mol. Its IUPAC name is [1-(2-bromo-6-methoxy-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(2-bromo-6-methoxy-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675726 |
| Molecular Formula | C11H12BrFN2O4S |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | [1-(2-bromo-6-methoxy-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | COc1ccc(N2CC(CS(=O)(=O)F)CC2=O)c(Br)n1 |
| InChI | InChI=1S/C11H12BrFN2O4S/c1-19-9-3-2-8(11(12)14-9)15-5-7(4-10(15)16)6-20(13,17)18/h2-3,7H,4-6H2,1H3 |
| InChIKey | ZIGPFJWTJJRNGV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|