C10H9Br2ClN2O3S — CID 168673863
[1-(2,6-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673863) has the molecular formula C10H9Br2ClN2O3S and a molecular weight of 432.52 g/mol. Its IUPAC name is [1-(2,6-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(2,6-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673863 |
| Molecular Formula | C10H9Br2ClN2O3S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 429.84 |
| IUPAC Name | [1-(2,6-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1ccc(Br)nc1Br |
| InChI | InChI=1S/C10H9Br2ClN2O3S/c11-8-2-1-7(10(12)14-8)15-4-6(3-9(15)16)5-19(13,17)18/h1-2,6H,3-5H2 |
| InChIKey | VMTDEUWTSKLXTI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|