C9H12N4OS — CID 168672251
1-(4-aminopyrimidin-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168672251) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-(4-aminopyrimidin-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-aminopyrimidin-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168672251 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-(4-aminopyrimidin-5-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | Nc1ncncc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C9H12N4OS/c10-9-7(2-11-5-12-9)13-3-6(4-15)1-8(13)14/h2,5-6,15H,1,3-4H2,(H2,10,11,12) |
| InChIKey | CGRZUHLZZWMLND-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|