C9H12N4O2S — CID 168671926
4-amino-5-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 168671926) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 4-amino-5-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-amino-5-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168671926 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-amino-5-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | Nc1nc[nH]c(=O)c1N1CC(CS)CC1=O |
| InChI | InChI=1S/C9H12N4O2S/c10-8-7(9(15)12-4-11-8)13-2-5(3-16)1-6(13)14/h4-5,16H,1-3H2,(H3,10,11,12,15) |
| InChIKey | MSAOAJOENRUWHX-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|