C10H10ClN5OS — CID 168671942
1-(2-chloro-7H-purin-6-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671942) has the molecular formula C10H10ClN5OS and a molecular weight of 283.74 g/mol. Its IUPAC name is 1-(2-chloro-7H-purin-6-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-chloro-7H-purin-6-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671942 |
| Molecular Formula | C10H10ClN5OS |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 1-(2-chloro-7H-purin-6-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1nc(Cl)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H10ClN5OS/c11-10-14-8-7(12-4-13-8)9(15-10)16-2-5(3-18)1-6(16)17/h4-5,18H,1-3H2,(H,12,13,14,15) |
| InChIKey | QRBUTGHSGNZMKT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|