C9H11N7O — CID 168700963
4-amino-1-(2-amino-7H-purin-6-yl)pyrrolidin-2-one (PubChem CID 168700963) has the molecular formula C9H11N7O and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-amino-1-(2-amino-7H-purin-6-yl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-(2-amino-7H-purin-6-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168700963 |
| Molecular Formula | C9H11N7O |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-amino-1-(2-amino-7H-purin-6-yl)pyrrolidin-2-one |
| SMILES | Nc1nc(N2CC(N)CC2=O)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H11N7O/c10-4-1-5(17)16(2-4)8-6-7(13-3-12-6)14-9(11)15-8/h3-4H,1-2,10H2,(H3,11,12,13,14,15) |
| InChIKey | XERRMOYINHPURT-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |