C10H11BrN6O — CID 168505942
1-(2-amino-7H-purin-6-yl)-4-(bromomethyl)pyrrolidin-2-one (PubChem CID 168505942) has the molecular formula C10H11BrN6O and a molecular weight of 311.14 g/mol. Its IUPAC name is 1-(2-amino-7H-purin-6-yl)-4-(bromomethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-amino-7H-purin-6-yl)-4-(bromomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168505942 |
| Molecular Formula | C10H11BrN6O |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1-(2-amino-7H-purin-6-yl)-4-(bromomethyl)pyrrolidin-2-one |
| SMILES | Nc1nc(N2CC(CBr)CC2=O)c2[nH]cnc2n1 |
| InChI | InChI=1S/C10H11BrN6O/c11-2-5-1-6(18)17(3-5)9-7-8(14-4-13-7)15-10(12)16-9/h4-5H,1-3H2,(H3,12,13,14,15,16) |
| InChIKey | KXRKHYFUDMPVED-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|