C9H12BrN5O — CID 168505923
4-(bromomethyl)-1-(4,6-diaminopyrimidin-5-yl)pyrrolidin-2-one (PubChem CID 168505923) has the molecular formula C9H12BrN5O and a molecular weight of 286.13 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(4,6-diaminopyrimidin-5-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(4,6-diaminopyrimidin-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168505923 |
| Molecular Formula | C9H12BrN5O |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-(bromomethyl)-1-(4,6-diaminopyrimidin-5-yl)pyrrolidin-2-one |
| SMILES | Nc1ncnc(N)c1N1CC(CBr)CC1=O |
| InChI | InChI=1S/C9H12BrN5O/c10-2-5-1-6(16)15(3-5)7-8(11)13-4-14-9(7)12/h4-5H,1-3H2,(H4,11,12,13,14) |
| InChIKey | UBBHYABCQTXJBR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|