C9H11BrN4O — CID 168506379
1-(3-aminopyrazin-2-yl)-4-(bromomethyl)pyrrolidin-2-one (PubChem CID 168506379) has the molecular formula C9H11BrN4O and a molecular weight of 271.12 g/mol. Its IUPAC name is 1-(3-aminopyrazin-2-yl)-4-(bromomethyl)pyrrolidin-2-one.
| Compound Name | 1-(3-aminopyrazin-2-yl)-4-(bromomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506379 |
| Molecular Formula | C9H11BrN4O |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 1-(3-aminopyrazin-2-yl)-4-(bromomethyl)pyrrolidin-2-one |
| SMILES | Nc1nccnc1N1CC(CBr)CC1=O |
| InChI | InChI=1S/C9H11BrN4O/c10-4-6-3-7(15)14(5-6)9-8(11)12-1-2-13-9/h1-2,6H,3-5H2,(H2,11,12) |
| InChIKey | XWFWBSVILBQZLZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|